Home
>
Chemical Reagents>Organic Building Blocks> 1-Bromo-2-fluoro-4-nitro-5-(trifluoromethyl)benzene
For research use only. Not for therapeutic Use.
1-Bromo-2-fluoro-4-nitro-5-(trifluoromethyl)benzene is a halogenated aromatic compound characterized by multiple substituents on a benzene ring. It features a bromine atom at the 1-position, a fluorine atom at the 2-position, a nitro group at the 4-position, and a trifluoromethyl group at the 5-position. This unique arrangement enhances its chemical reactivity, making it valuable in organic synthesis and materials science. The presence of both electron-withdrawing and electron-donating groups can influence its reactivity and applications in drug discovery and agrochemicals.
CAS Number | 1121586-27-3 |
Molecular Formula | C7H2BrF4NO2 |
Purity | ≥95% |
IUPAC Name | 1-bromo-2-fluoro-4-nitro-5-(trifluoromethyl)benzene |
InChI | InChI=1S/C7H2BrF4NO2/c8-4-1-3(7(10,11)12)6(13(14)15)2-5(4)9/h1-2H |
InChIKey | GFEHSQQQPODKHJ-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1Br)F)[N+](=O)[O-])C(F)(F)F |