For research use only. Not for therapeutic Use.
1-Bromo-2-iodobenzene(Cat No.:R063757)is a versatile organobromine compound widely used in synthetic organic chemistry. Its unique halogenated structure serves as an important building block for the development of various functionalized molecules. This compound is particularly valuable in cross-coupling reactions, such as Suzuki and Sonogashira coupling, enabling the formation of carbon-carbon bonds. Additionally, 1-Bromo-2-iodobenzene can participate in nucleophilic substitution reactions, expanding its application in the synthesis of complex organic compounds. Its reactivity and compatibility with diverse reaction conditions make it an essential tool for chemists in pharmaceutical and materials research.
CAS Number | 583-55-1 |
Synonyms | 1-Iodo-2-bromobenzene; 2-Bromo-1-iodobenzene; 2-Bromoiodobenzene; 2-Bromophenyl iodide; 2-Iodo-1-bromobenzene; 2-Iodobromobenzene; o-Bromoiodobenzene; o-Bromophenyl iodide; o-Iodobromobenzene |
Molecular Formula | C6H4BrI |
Purity | ≥95% |
Storage | 3 years -20C powder |
IUPAC Name | 1-bromo-2-iodobenzene |
InChI | InChI=1S/C6H4BrI/c7-5-3-1-2-4-6(5)8/h1-4H |
InChIKey | OIRHKGBNGGSCGS-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)Br)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |