For research use only. Not for therapeutic Use.
1-Bromo-2-methoxy-3-nitrobenzene is a versatile organic compound commonly used in chemical synthesis and research. It features a bromine atom at the 1-position, a methoxy group at the 2-position, and a nitro group at the 3-position of the benzene ring. This structure makes it valuable in the preparation of pharmaceuticals, agrochemicals, and other aromatic compounds. Its unique functional groups provide reactivity for electrophilic substitution reactions and serve as intermediates in the synthesis of more complex molecules.
CAS Number | 98775-19-0 |
Molecular Formula | C7H6BrNO3 |
Purity | ≥95% |
IUPAC Name | 1-bromo-2-methoxy-3-nitrobenzene |
InChI | InChI=1S/C7H6BrNO3/c1-12-7-5(8)3-2-4-6(7)9(10)11/h2-4H,1H3 |
InChIKey | YAYBLVOBUIXMQY-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC=C1Br)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |