Home
>
Isotope Labeled Compounds>Isotope Labeled Synthetic Intermediates> 1-Bromo-2-methylpropane-d7
For research use only. Not for therapeutic Use.
1-Bromo-2-methylpropane-d7 is a deuterium-labeled compound, featuring seven deuterium atoms, making it essential for advanced research in organic chemistry and pharmaceuticals. This isotopically labeled compound is used primarily in studies involving reaction mechanisms, metabolic pathways, and the synthesis of labeled analogs for drug development. Its stable isotope labeling enhances the accuracy of spectroscopic analyses, such as NMR, allowing for precise monitoring of chemical processes. 1-Bromo-2-methylpropane-d7 is a reliable and versatile reagent, integrating seamlessly into various experimental protocols, offering enhanced stability and consistency for high-precision scientific investigations.
CAS Number | 344299-41-8 |
Synonyms | 1-Methyl-2-propyl Bromide-d7; 2-Methylpropyl Bromide-d7; Bromoisobutane-d7; Isobutyl Bromide-d7; NSC 8416-d7; iso-Butyl Bromide-d7 |
Molecular Formula | C4H9Br |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | 2-(bromomethyl)-1,1,1,2,3,3,3-heptadeuteriopropane |
InChI | InChI=1S/C4H9Br/c1-4(2)3-5/h4H,3H2,1-2H3/i1D3,2D3,4D |
InChIKey | HLVFKOKELQSXIQ-UAVYNJCWSA-N |
SMILES | [2H]C([2H])([2H])C([2H])(CBr)C([2H])([2H])[2H] |