For research use only. Not for therapeutic Use.
1-Bromo-3-(2-methylpropoxy)benzene(Cat No.:L019404)is a chemically modified benzene derivative featuring a bromo group at the 1-position and a 2-methylpropoxy group at the 3-position. This configuration provides useful reactive sites for further chemical transformations, making it a valuable intermediate in organic synthesis. The bromo group facilitates electrophilic aromatic substitution reactions, while the 2-methylpropoxy group enhances solubility in organic solvents and offers potential for nucleophilic attack or further modification. This compound is particularly useful in the pharmaceutical and agrochemical industries for synthesizing more complex molecules with specific desired properties.
CAS Number | 223564-75-8 |
Molecular Formula | C10H13BrO |
Purity | ≥95% |
IUPAC Name | 1-bromo-3-(2-methylpropoxy)benzene |
InChI | InChI=1S/C10H13BrO/c1-8(2)7-12-10-5-3-4-9(11)6-10/h3-6,8H,7H2,1-2H3 |
InChIKey | QTAHPJXZROQDCU-UHFFFAOYSA-N |
SMILES | CC(C)COC1=CC(=CC=C1)Br |