For research use only. Not for therapeutic Use.
1-Bromo-3-chloro-5-(trifluoromethyl)benzene（Cat No.:L040103）is a halogenated aromatic compound used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound features a trifluoromethyl group at the 5-position, with bromine and chlorine atoms at the 1- and 3-positions, respectively, making it highly reactive for various substitution reactions. Its unique structure is valuable for creating complex molecules, including potential drug candidates and active ingredients. Its versatility and reactivity make it an essential building block in medicinal chemistry and material science.
| Catalog Number | L040103 |
| CAS Number | 928783-85-1 |
| Molecular Formula | C7H3BrClF3 |
| Purity | ≥95% |
| IUPAC Name | 1-bromo-3-chloro-5-(trifluoromethyl)benzene |
| InChI | InChI=1S/C7H3BrClF3/c8-5-1-4(7(10,11)12)2-6(9)3-5/h1-3H |
| InChIKey | QRPRXRQFNNXPBA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Br)C(F)(F)F |
