For research use only. Not for therapeutic Use.
1-Bromo-3-cyclobutylbenzene (Cat.No:L003547) is a significant organic compound with versatile applications in synthesis and pharmaceutical research. Its unique cyclobutyl group imparts distinctive reactivity, making it a valuable building block in the preparation of complex molecules. This compound is employed in the creation of specialized pharmaceutical agents, showcasing its importance in drug development.
CAS Number | 17789-13-8 |
Molecular Formula | C10H11Br |
Purity | ≥95% |
IUPAC Name | 1-bromo-3-cyclobutylbenzene |
InChI | InChI=1S/C10H11Br/c11-10-6-2-5-9(7-10)8-3-1-4-8/h2,5-8H,1,3-4H2 |
InChIKey | FIILPMPZIQFZCG-UHFFFAOYSA-N |
SMILES | C1CC(C1)C2=CC(=CC=C2)Br |