For research use only. Not for therapeutic Use.
1-Bromo-3,7-dimethyloctane (Cat.No:R052609) is a chemical compound known for its use in organic synthesis. It contains a bromine atom attached to a branched carbon chain with two methyl groups. This compound serves as a valuable intermediate in the creation of complex organic molecules and is used in various research and industrial processes.
Catalog Number | R052609 |
CAS Number | 3383-83-3 |
Synonyms | (±)-1-Bromo-3,7-dimethyloctane; 3,7-Dimethyl-1-bromooctane; 3,7-Dimethyloctyl Bromide; Dihydrocitronellyl Bromide; Perhydrogeranyl Bromide; Tetrahydrogeranyl Bromide; |
Molecular Formula | C10H21Br |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-bromo-3,7-dimethyloctane |
InChI | InChI=1S/C10H21Br/c1-9(2)5-4-6-10(3)7-8-11/h9-10H,4-8H2,1-3H3 |
InChIKey | VGSUDZKDSKCYJP-UHFFFAOYSA-N |
SMILES | CC(C)CCCC(C)CCBr |