For research use only. Not for therapeutic Use.
1-Bromo-4-(2,2-dibromoethenyl)benzene(Cat No.:L007699), is a chemical compound featuring a benzene ring substituted with a bromine atom at the 1-position and a 2,2-dibromoethenyl group at the 4-position. This specific molecular structure is significant in organic synthesis and materials science. Researchers utilize it as a key intermediate for creating specialized organic molecules, particularly in developing specialty chemicals, agrochemicals, and advanced materials.
CAS Number | 136350-66-8 |
Molecular Formula | C8H5Br3 |
Purity | ≥95% |
IUPAC Name | 1-bromo-4-(2,2-dibromoethenyl)benzene |
InChI | InChI=1S/C8H5Br3/c9-7-3-1-6(2-4-7)5-8(10)11/h1-5H |
InChIKey | WLRQSEXHEFWAJG-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C=C(Br)Br)Br |