For research use only. Not for therapeutic Use.
2-Bromo-5-chloronitrobenzene (Cat. No: R018346) is mainly used as a pharmaceutical intermediate for the synthesis of compounds, such as diindolyl carbazole, new benzene sulfonamides and ladder oligomers in organic electronics. It can also be used to discover effective cell cycle inhibitors.
| CAS Number | 41513-04-6 |
| Synonyms | 1-Bromo-2-nitro-4-chlorobenzene; 1-Bromo-4-chloro-2-nitrobenzene; 2-Bromo-5-chloronitrobenzene; 4-Bromo-3-nitrochlorobenzene; 4-Chloro-2-bromonitrobenzene |
| Molecular Formula | C6H3BrClNO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-bromo-4-chloro-2-nitrobenzene |
| InChI | InChI=1S/C6H3BrClNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
| InChIKey | UKTIMFAJRPSNGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)[N+](=O)[O-])Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
