For research use only. Not for therapeutic Use.
1-Bromo-4-(cyclohexyloxy)benzene is an aromatic compound featuring a bromine atom and a cyclohexyloxy group on a benzene ring. This compound is commonly used as an intermediate in organic synthesis, particularly for cross-coupling reactions in pharmaceutical and materials research. Its bromine substituent enables further functionalization, making it valuable for constructing complex molecules. The cyclohexyloxy group provides stability and hydrophobic properties, supporting applications in the development of bioactive compounds and specialty materials in medicinal chemistry and polymer science.
CAS Number | 30752-31-9 |
Molecular Formula | C12H15BrO |
Purity | ≥95% |
IUPAC Name | 1-bromo-4-cyclohexyloxybenzene |
InChI | InChI=1S/C12H15BrO/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h6-9,11H,1-5H2 |
InChIKey | YFUDIBSZKPCLQH-UHFFFAOYSA-N |
SMILES | C1CCC(CC1)OC2=CC=C(C=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |