For research use only. Not for therapeutic Use.
1-Bromo-4-fluoro-2-methoxy-5-methylbenzene(CAT: L037062) is a halogenated aromatic compound commonly used in pharmaceutical and chemical research. Featuring bromine, fluorine, methoxy, and methyl substituents on a benzene ring, it serves as a versatile building block for synthesizing complex molecules, including bioactive compounds and advanced materials. This compound is particularly valuable in cross-coupling reactions and other organic transformations, enabling the development of novel therapeutic agents and functional materials. With high purity and stability, 1-Bromo-4-fluoro-2-methoxy-5-methylbenzene supports innovative research in medicinal chemistry and synthetic organic chemistry.
CAS Number | 314298-15-2 |
Molecular Formula | C8H8BrFO |
Purity | ≥95% |
IUPAC Name | 1-bromo-4-fluoro-2-methoxy-5-methylbenzene |
InChI | InChI=1S/C8H8BrFO/c1-5-3-6(9)8(11-2)4-7(5)10/h3-4H,1-2H3 |
InChIKey | JHHKWHVDJFQNNG-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1F)OC)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |