For research use only. Not for therapeutic Use.
1-Bromo-4-(trans-4-propylcyclohexyl)benzene is a brominated aromatic compound often used in liquid crystal research and material science. Featuring a bromobenzene core with a trans-4-propylcyclohexyl group, this compound exhibits stability and flexibility, making it valuable in developing liquid crystal materials for display technologies. The bromine atom allows for further functionalization, enabling its use as an intermediate in organic synthesis. It supports applications in advanced materials, aiding in the design of compounds with specific optical and electrochemical properties.
CAS Number | 86579-53-5 |
Molecular Formula | C15H21Br |
Purity | ≥95% |
IUPAC Name | 1-bromo-4-(4-propylcyclohexyl)benzene |
InChI | InChI=1S/C15H21Br/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(16)11-9-14/h8-13H,2-7H2,1H3 |
InChIKey | GMZABADCQVWQPS-UHFFFAOYSA-N |
SMILES | CCCC1CCC(CC1)C2=CC=C(C=C2)Br |