For research use only. Not for therapeutic Use.
1-Bromo-6-methoxyisoquinoline(Cat No.:L007405), is a chemical compound with the molecular formula C10H8BrNO. This compound belongs to the class of isoquinolines, which are bicyclic aromatic compounds. The presence of a bromine atom and a methoxy group in the structure imparts specific reactivity and properties to this compound, making it useful in various chemical transformations. Isoquinoline derivatives often find applications in medicinal chemistry, agrochemicals, and materials science.
CAS Number | 1196152-83-6 |
Molecular Formula | C10H8BrNO |
Purity | ≥95% |
IUPAC Name | 1-bromo-6-methoxyisoquinoline |
InChI | InChI=1S/C10H8BrNO/c1-13-8-2-3-9-7(6-8)4-5-12-10(9)11/h2-6H,1H3 |
InChIKey | CDEUKMWYVZMNFN-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(C=C1)C(=NC=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |