For research use only. Not for therapeutic Use.
1-Bromo-8-chlorodibenzo[b,d]furan (Cat.No:L003591) is a notable chemical compound with significant applications in organic synthesis and materials science. Its distinctive fused-ring structure, incorporating bromine and chlorine atoms, offers unique reactivity for various chemical transformations. This compound serves as a valuable building block in the creation of specialized materials and pharmaceuticals.
CAS Number | 2173554-83-9 |
Molecular Formula | C12H6BrClO |
Purity | ≥95% |
IUPAC Name | 1-bromo-8-chlorodibenzofuran |
InChI | InChI=1S/C12H6BrClO/c13-9-2-1-3-11-12(9)8-6-7(14)4-5-10(8)15-11/h1-6H |
InChIKey | LMGAQFSQAOXEDZ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=C1)Br)C3=C(O2)C=CC(=C3)Cl |