For research use only. Not for therapeutic Use.
(1-Bromocyclopropyl)methanol(Cat No.:L007831), is a chemical compound featuring a cyclopropyl ring attached to a methanol group, which has applications in organic synthesis. Its unique cyclopropyl structure makes it a valuable intermediate in the preparation of complex organic molecules. Researchers use this compound to introduce the cyclopropyl motif into various target molecules, enabling the synthesis of biologically active compounds, natural products, and pharmaceutical agents.
CAS Number | 50915-29-2 |
Molecular Formula | C4H7BrO |
Purity | ≥95% |
IUPAC Name | (1-bromocyclopropyl)methanol |
InChI | InChI=1S/C4H7BrO/c5-4(3-6)1-2-4/h6H,1-3H2 |
InChIKey | WKFDDISTWXHCAW-UHFFFAOYSA-N |
SMILES | C1CC1(CO)Br |