For research use only. Not for therapeutic Use.
1-Butan-d9-ol(Cat No.:R041492)is a high-purity, fully deuterated alcohol essential for advanced pharmaceutical and chemical research. This isotopically labeled version of 1-Butanol, featuring nine deuterium atoms, is crucial for studies involving metabolic pathways, NMR spectroscopy, and reaction mechanisms. The stable isotope labeling ensures precise and reliable analytical results, enhancing experimental accuracy. Ideal for various research applications, 1-Butan-d9-ol integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations and the development of innovative chemical and pharmaceutical processes.
CAS Number | 25493-17-8 |
Synonyms | 1-Butan-1,1,2,2,3,3,4,4,4-d9-ol; |
Molecular Formula | C4H10O |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 1,1,2,2,3,3,4,4,4-nonadeuteriobutan-1-ol |
InChI | InChI=1S/C4H10O/c1-2-3-4-5/h5H,2-4H2,1H3/i1D3,2D2,3D2,4D2 |
InChIKey | LRHPLDYGYMQRHN-YNSOAAEFSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |