For research use only. Not for therapeutic Use.
1-Butanamine-d9(Cat No.:R015672) is a high-purity, deuterated compound essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of 1-Butanamine features nine deuterium atoms, allowing for precise tracking in metabolic and analytical studies. Its stable isotope labeling ensures accurate and reproducible results, making it ideal for use in NMR spectroscopy, mass spectrometry, and other sophisticated analytical techniques. This compound is crucial for researchers focusing on amine metabolism, organic synthesis, and pharmacokinetics, providing a robust and reliable solution for high-precision scientific investigations.
Catalog Number | R015672 |
CAS Number | 776285-22-4 |
Synonyms | n-Butyl-d9-amine; 1-Aminobutane-d9; 1-Butylamine-d9; Mono-n-butylamine-d9; Monobutylamine-d9; NSC 8029-d9; Norvalamine-d9; n-Butylamine-d9; |
Molecular Formula | C4H11N |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 1,1,2,2,3,3,4,4,4-nonadeuteriobutan-1-amine |
InChI | InChI=1S/C4H11N/c1-2-3-4-5/h2-5H2,1H3/i1D3,2D2,3D2,4D2 |
InChIKey | HQABUPZFAYXKJW-YNSOAAEFSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N |