For research use only. Not for therapeutic Use.
1-Butyl-2-methylimidazole is an imidazole derivative characterized by a butyl group at the 1-position and a methyl group at the 2-position. This compound is significant in organic synthesis and coordination chemistry due to its ability to act as a ligand and a base. Its unique structure enhances solubility in various solvents, making it useful in applications such as ionic liquids and catalysts. Additionally, 1-butyl-2-methylimidazole exhibits potential biological activities, including antifungal and antimicrobial properties, making it of interest in medicinal chemistry.
CAS Number | 13435-22-8 |
Molecular Formula | C8H14N2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-butyl-2-methylimidazole |
InChI | InChI=1S/C8H14N2/c1-3-4-6-10-7-5-9-8(10)2/h5,7H,3-4,6H2,1-2H3 |
InChIKey | WHLZPGRDRYCVRQ-UHFFFAOYSA-N |
SMILES | CCCCN1C=CN=C1C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |