For research use only. Not for therapeutic Use.
1-Butyl-3-methylimidazolium hydroxide is an ionic liquid, consisting of a 1-butyl-3-methylimidazolium cation and a hydroxide anion. Ionic liquids like this one are known for their unique properties, including low volatility, high thermal stability, and the ability to dissolve a wide range of substances. 1-Butyl-3-methylimidazolium hydroxide is often used as a solvent or catalyst in organic synthesis, electrochemistry, and green chemistry due to its environmentally friendly nature compared to traditional organic solvents. Its hydroxide anion also makes it useful in base-catalyzed reactions and processes like CO2 capture and biomass processing.
CAS Number | 528818-81-7 |
Synonyms | 1-Butyl-3-MethyliMidazoliuM hydroxide;1-n-butyl-3-methylimidazolium hydroxide, 25% in Ethanol;BMIMOH;3-Butyl-1-methyl-1H-imidazol-3-ium hydroxide |
Molecular Formula | C8H16N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-butyl-3-methylimidazol-3-ium;hydroxide |
InChI | InChI=1S/C8H15N2.H2O/c1-3-4-5-10-7-6-9(2)8-10;/h6-8H,3-5H2,1-2H3;1H2/q+1;/p-1 |
InChIKey | BXOAIZOIDUQOFA-UHFFFAOYSA-M |
SMILES | CCCCN1C=C[N+](=C1)C.[OH-] |