For research use only. Not for therapeutic Use.
1-Cbz-azetidine-3-carboxylic acid(Cat No.:L028307)is a high-purity, protected amino acid derivative used extensively in pharmaceutical and chemical research. This compound features an azetidine ring with a carboxylic acid group at the 3-position and a benzyloxycarbonyl (Cbz) protecting group on the nitrogen atom. It serves as a versatile intermediate in the synthesis of peptides and bioactive molecules, offering stability and reactivity in selective chemical transformations. 1-Cbz-azetidine-3-carboxylic acid is essential for precise synthetic applications, contributing to advancements in medicinal chemistry and peptide synthesis.
CAS Number | 97628-92-7 |
Molecular Formula | C12H13NO4 |
Purity | ≥95% |
Target | PROTAC |
IUPAC Name | 1-phenylmethoxycarbonylazetidine-3-carboxylic acid |
InChI | InChI=1S/C12H13NO4/c14-11(15)10-6-13(7-10)12(16)17-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,15) |
InChIKey | PVJPBKZGIUAESY-UHFFFAOYSA-N |
SMILES | C1C(CN1C(=O)OCC2=CC=CC=C2)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |