For research use only. Not for therapeutic Use.
1-Chloro-3-iodo-2-methoxybenzene(CAT: L000206) is a valuable compound in organic chemistry. It plays a pivotal role as an important intermediate in the synthesis of various organic molecules, including pharmaceuticals and agrochemicals. Its halogen substitution pattern provides unique reactivity, allowing for precise structural modifications.
Catalog Number | L000206 |
CAS Number | 860585-01-9 |
Molecular Formula | C7H6ClIO |
Purity | ≥95% |
IUPAC Name | 1-chloro-3-iodo-2-methoxybenzene |
InChI | InChI=1S/C7H6ClIO/c1-10-7-5(8)3-2-4-6(7)9/h2-4H,1H3 |
InChIKey | OOEJMUOZUDREAD-UHFFFAOYSA-N |