For research use only. Not for therapeutic Use.
1-Chloro-3-iodo-2-methoxybenzene(CAT: L000206) is a valuable compound in organic chemistry. It plays a pivotal role as an important intermediate in the synthesis of various organic molecules, including pharmaceuticals and agrochemicals. Its halogen substitution pattern provides unique reactivity, allowing for precise structural modifications.
| CAS Number | 860585-01-9 |
| Molecular Formula | C7H6ClIO |
| Purity | ≥95% |
| IUPAC Name | 1-chloro-3-iodo-2-methoxybenzene |
| InChI | InChI=1S/C7H6ClIO/c1-10-7-5(8)3-2-4-6(7)9/h2-4H,1H3 |
| InChIKey | OOEJMUOZUDREAD-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
