For research use only. Not for therapeutic Use.
1-Chloro-3-methoxy-2-nitrobenzene(CAT: M177483) is a high-purity aromatic compound widely used as an intermediate in pharmaceutical and chemical research. Its structure includes a chloro substituent, a methoxy group, and a nitro functionality on a benzene ring, offering versatility for targeted chemical transformations. This compound serves as a critical building block in the synthesis of bioactive molecules, agrochemicals, and advanced materials. Its unique reactivity makes it ideal for nucleophilic substitutions, reduction reactions, and heterocyclic framework construction. 1-Chloro-3-methoxy-2-nitrobenzene ensures reliability and precision in research applications, supporting innovative developments in medicinal chemistry and synthetic organic chemistry.
CAS Number | 5472-99-1 |
Molecular Formula | C7H6ClNO3 |
Purity | ≥95% |
IUPAC Name | 1-chloro-3-methoxy-2-nitrobenzene |
InChI | InChI=1S/C7H6ClNO3/c1-12-6-4-2-3-5(8)7(6)9(10)11/h2-4H,1H3 |
InChIKey | JFDFFRYBIFYDKP-UHFFFAOYSA-N |
SMILES | COC1=C(C(=CC=C1)Cl)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |