1-Chloro-3-nitrobenzene-13C6（Cat No.:R014310） is a high-purity isotopically labeled compound essential for advanced pharmaceutical and environmental research. This version of 1-Chloro-3-nitrobenzene, featuring six carbon-13 atoms, is crucial for studies involving pollutant tracking, chemical synthesis, and reaction mechanisms. Its stable isotope labeling ensures precise and reliable analytical results. With enhanced stability and consistency, it is suitable for various experimental setups. Ideal for analytical chemistry and environmental monitoring, 1-Chloro-3-nitrobenzene-13C6 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | R014310 |
| CAS Number | NA |
| Synonyms | 3-Chloro-1-nitrobenzene-13C6; 3-Chloronitrobenzene-13C6; 3-Nitro-1-chlorobenzene-13C6; 3-Nitrochlorobenzene-13C6; 3-Nitrophenyl-13C6 chloride; NSC 5502-13C6; m-Chloronitrobenzene-13C6; m-Nitrochlorobenzene-13C6 |
| Molecular Formula | ¹³C₆H₄ClNO₂ |
| Purity | 95% |
| Storage | Store at RT |
| IUPAC Name | 3-chloro-1-nitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChI | InChI=1S/C6H4ClNO2/c7-5-2-1-3-6(4-5)8(9)10/h1-4H/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | KMAQZIILEGKYQZ-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13C](=[13CH]1)Cl)[N+](=O)[O-] |
