For research use only. Not for therapeutic Use.
1-Chloro-3-phenylacetone (Cat.No:L003533) is a crucial intermediate in organic synthesis. Its structure features a phenyl group attached to a ketone and a chlorine atom, endowing it with diverse reactivity. This compound serves as a key building block in the preparation of various pharmaceuticals and fine chemicals.
CAS Number | 937-38-2 |
Molecular Formula | C9H9ClO |
Purity | ≥95% |
IUPAC Name | 1-chloro-3-phenylpropan-2-one |
InChI | InChI=1S/C9H9ClO/c10-7-9(11)6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
InChIKey | NIOHSOXYJMSVOA-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CC(=O)CCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |