For research use only. Not for therapeutic Use.
1-Chloro-4-(chlorophenylmethyl)benzene (Cat.No:R022537) is a chemical compound used as a versatile intermediate in organic synthesis. Its structure features a benzene ring substituted with a chloro group and a chlorophenylmethyl group. This compound serves as a building block in the creation of various chemicals and pharmaceuticals.
CAS Number | 134-83-8 |
Synonyms | Chloro(p-chlorophenyl)phenylmethane; 1-Chloro-4-(chloro(phenyl)methyl)benzene; 4-Chlorobenzhydryl Chloride; Chloro(p-chlorophenyl)phenylmethane; NSC 49126; p-Chlorobenzhydryl Chloride |
Molecular Formula | C13H10Cl2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-chloro-4-[chloro(phenyl)methyl]benzene |
InChI | InChI=1S/C13H10Cl2/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9,13H |
InChIKey | ALKWTKGPKKAZMN-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)Cl)Cl |