1-Chloro-4-iodo-[2,7]naphthyridine is a halogenated heterocyclic compound featuring both chlorine and iodine substitutions on a naphthyridine core. This unique molecular structure makes it valuable in organic synthesis, particularly for cross-coupling reactions such as Suzuki or Sonogashira couplings, where it can serve as a versatile building block. Its reactivity and potential for further functionalization make it useful in pharmaceutical research and the development of novel compounds. It is also explored for its potential biological activities in drug discovery.
Catalog Number | L033204 |
CAS Number | 1234616-02-4 |
Molecular Formula | C8H4ClIN2 |
Purity | ≥95% |
IUPAC Name | 1-chloro-4-iodo-2,7-naphthyridine |
InChI | InChI=1S/C8H4ClIN2/c9-8-6-3-11-2-1-5(6)7(10)4-12-8/h1-4H |
InChIKey | YIJURXYCTRQJAG-UHFFFAOYSA-N |