For research use only. Not for therapeutic Use.
1-Chloro-4-(methoxymethyl)benzene(Cat No.:L032593)is an aromatic compound used in organic synthesis and pharmaceutical research. The molecule features a benzene ring with a chlorine atom at the 1-position and a methoxymethyl group at the 4-position, offering unique reactivity. This compound is valuable as an intermediate in the synthesis of complex molecules, including pharmaceuticals and fine chemicals. The presence of the methoxymethyl group allows for further functionalization, making it useful in various chemical transformations. It is essential for researchers focused on drug discovery, medicinal chemistry, and material science.
CAS Number | 1195-44-4 |
Molecular Formula | C8H9ClO |
Purity | ≥95% |
IUPAC Name | 1-chloro-4-(methoxymethyl)benzene |
InChI | InChI=1S/C8H9ClO/c1-10-6-7-2-4-8(9)5-3-7/h2-5H,6H2,1H3 |
InChIKey | YOZIDEHIYNEGMS-UHFFFAOYSA-N |
SMILES | COCC1=CC=C(C=C1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |