For research use only. Not for therapeutic Use.
1-Chloro-4-propoxythioxanthone (Cat No.:M101459) is a chemical compound. It comprises a xanthone core substituted with a chlorine atom and a propoxy group. This compound holds significance in the field of photoinitiators for UV-curing applications. When exposed to ultraviolet light, it undergoes photolysis to generate reactive species, initiating polymerization processes in coatings, inks, and adhesives. Its photochemical properties make it valuable in producing cured materials with controlled properties. The compound’s ability to initiate polymerization upon UV exposure contributes to its role in enabling efficient and versatile processes in the manufacturing of UV-curable materials.
CAS Number | 142770-42-1 |
Molecular Formula | C16H13ClO2S |
Purity | ≥95% |
Documentation | |
Storage | Desiccate at RT |
IUPAC Name | 1-chloro-4-propoxythioxanthen-9-one |
InChI | InChI=1S/C16H13ClO2S/c1-2-9-19-12-8-7-11(17)14-15(18)10-5-3-4-6-13(10)20-16(12)14/h3-8H,2,9H2,1H3 |
InChIKey | VKQJCUYEEABXNK-UHFFFAOYSA-N |
SMILES | CCCOC1=C2C(=C(C=C1)Cl)C(=O)C3=CC=CC=C3S2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |