For research use only. Not for therapeutic Use.
1-Chloro-6-fluoroisoquinoline(Cat No.:L035351)is a halogenated heterocyclic compound commonly used in pharmaceutical and chemical research. With both chlorine and fluorine atoms attached to an isoquinoline ring, this compound exhibits unique reactivity, making it a valuable building block in the synthesis of complex molecules. It is often employed in the development of new therapeutic agents, particularly in the design of kinase inhibitors and other biologically active compounds. Its dual halogenation enhances its utility in creating diverse chemical libraries, facilitating drug discovery and medicinal chemistry research.
CAS Number | 214045-86-0 |
Molecular Formula | C9H5ClFN |
Purity | ≥95% |
IUPAC Name | 1-chloro-6-fluoroisoquinoline |
InChI | InChI=1S/C9H5ClFN/c10-9-8-2-1-7(11)5-6(8)3-4-12-9/h1-5H |
InChIKey | QZBWBBHQRLUOTM-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CN=C2Cl)C=C1F |