For research use only. Not for therapeutic Use.
1-Chloro-1H-pyrrolo[1,2-a]pyrazine is a versatile heterocyclic compound used in pharmaceutical research and organic synthesis. Its unique structure makes it valuable for drug discovery, especially in the development of bioactive molecules. With a chlorine atom at position 1, it offers opportunities for further functionalization and chemical modifications. This compound is particularly useful in the design of kinase inhibitors and other therapeutic agents, contributing to advancements in medicinal chemistry and molecular research.
CAS Number | 136927-64-5 |
Molecular Formula | C7H5ClN2 |
Purity | ≥95% |
Storage | Store at +4 ℃ |
IUPAC Name | 1-chloropyrrolo[1,2-a]pyrazine |
InChI | InChI=1S/C7H5ClN2/c8-7-6-2-1-4-10(6)5-3-9-7/h1-5H |
InChIKey | UECDOWHLPZJHSY-UHFFFAOYSA-N |
SMILES | C1=CN2C=CN=C(C2=C1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |