For research use only. Not for therapeutic Use.
1-Chloropropan-2-amine hydrochloride(Cat No.:L006749). It consists of a chlorinated alkylamine with a hydrochloride salt form. This compound is used as a key intermediate in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals. Its structure allows it to participate in diverse chemical reactions, making it valuable in the creation of complex molecules. Researchers employ it in organic synthesis and medicinal chemistry, enabling the development of new drugs and specialized chemicals. Its versatile nature makes it an essential tool in chemical research and drug discovery processes.
CAS Number | 5968-21-8 |
Molecular Formula | C3H9Cl2N |
Purity | ≥95% |
IUPAC Name | 1-chloropropan-2-amine;hydrochloride |
InChI | InChI=1S/C3H8ClN.ClH/c1-3(5)2-4;/h3H,2,5H2,1H3;1H |
InChIKey | JCYHBVQFOAWROY-UHFFFAOYSA-N |
SMILES | CC(CCl)N.Cl |