For research use only. Not for therapeutic Use.
1-cis-2-cis-3-Trimethylcyclopentane is a high-purity compound essential for advanced pharmaceutical and chemical research. This cyclopentane derivative is crucial for studies involving stereochemistry, organic synthesis, and chemical intermediates. Known for its stability and specific cis-configuration, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
CAS Number | 2613-69-6 |
Synonyms | (1α,2α,3α)-1,2,3-Trimethylcyclopentane; |
Molecular Formula | C8H16 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (1R,3S)-1,2,3-trimethylcyclopentane |
InChI | InChI=1S/C8H16/c1-6-4-5-7(2)8(6)3/h6-8H,4-5H2,1-3H3/t6-,7+,8? |
InChIKey | VCWNHOPGKQCXIQ-DHBOJHSNSA-N |
SMILES | CC1CCC(C1C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |