For research use only. Not for therapeutic Use.
1-(cis-4-Aminocyclohexyl)ethanone hydrochloride (CAT: L000253) is a crucial compound primarily used in pharmaceutical and organic chemistry. In pharmaceutical research, it serves as a vital intermediate for the synthesis of pharmaceutical agents. This compound plays a pivotal role in the development of drugs and drug candidates, influencing their biological activity and pharmacological properties.
| Catalog Number | L000253 |
| CAS Number | 879876-86-5 |
| Molecular Formula | C8H16ClNO |
| Purity | ≥95% |
| IUPAC Name | 1-(4-aminocyclohexyl)ethanone;hydrochloride |
| InChI | InChI=1S/C8H15NO.ClH/c1-6(10)7-2-4-8(9)5-3-7;/h7-8H,2-5,9H2,1H3;1H |
| InChIKey | BIMXYHFQLAWZMO-UHFFFAOYSA-N |
