For research use only. Not for therapeutic Use.
1-Cyanobenzotriazole（Cat No.:M080732）is a valuable reagent in organic synthesis and pharmaceutical research, known for its reactivity and versatility. Featuring a benzotriazole ring with a cyano group, it is commonly used as a coupling agent, facilitating peptide bond formation and other condensation reactions. Its stability and efficiency make it a preferred choice for synthesizing bioactive molecules and complex organic compounds. This compound is frequently employed in drug discovery and medicinal chemistry for the development of inhibitors, catalysts, and other therapeutic agents, offering enhanced reactivity in various chemical processes.
| Catalog Number | M080732 |
| CAS Number | 15328-32-2 |
| Molecular Formula | C7H4N4 |
| Purity | ≥95% |
| IUPAC Name | benzotriazole-1-carbonitrile |
| InChI | InChI=1S/C7H4N4/c8-5-11-7-4-2-1-3-6(7)9-10-11/h1-4H |
| InChIKey | JPUHPGALPBINPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=NN2C#N |
