For research use only. Not for therapeutic Use.
1-Cyanocyclohexane-1-carboxylic acid(Cat No.:L020864)is a cyclic compound used as an intermediate in organic synthesis and pharmaceutical research. Featuring a cyano and carboxylic acid group on a cyclohexane ring, it offers dual reactivity for chemical modifications. This compound is commonly employed in the development of bioactive molecules, including drug candidates, and is valuable in synthesizing complex heterocyclic structures. Its stable structure and functional groups make it suitable for medicinal chemistry, contributing to the creation of novel therapeutic agents, agrochemicals, and advanced materials for various industrial applications.
CAS Number | 227203-34-1 |
Molecular Formula | C8H11NO2 |
Purity | ≥95% |
IUPAC Name | 1-cyanocyclohexane-1-carboxylic acid |
InChI | InChI=1S/C8H11NO2/c9-6-8(7(10)11)4-2-1-3-5-8/h1-5H2,(H,10,11) |
InChIKey | ISEJXQAAWBXLGB-UHFFFAOYSA-N |
SMILES | C1CCC(CC1)(C#N)C(=O)O |