Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-Cyclobutylpiperidin-4-amine dihydrochloride
For research use only. Not for therapeutic Use.
1-Cyclobutylpiperidin-4-amine dihydrochloride(CAT: L026596) is an organic compound that features a piperidine ring with an amine group at position 4 and a cyclobutyl group attached to the nitrogen. In its dihydrochloride salt form, the compound is more stable and water-soluble, which makes it useful for pharmaceutical research and chemical applications. Piperidine derivatives are commonly explored in medicinal chemistry due to their presence in bioactive molecules and potential as intermediates in drug development. This specific structure, with a cyclobutyl group, may influence the compound’s pharmacokinetics and biological interactions, making it valuable for developing therapeutic agents.
CAS Number | 1176419-57-0 |
Molecular Formula | C9H20Cl2N2 |
Purity | ≥95% |
IUPAC Name | 1-cyclobutylpiperidin-4-amine;dihydrochloride |
InChI | InChI=1S/C9H18N2.2ClH/c10-8-4-6-11(7-5-8)9-2-1-3-9;;/h8-9H,1-7,10H2;2*1H |
InChIKey | AQQYZSZWSFSEBT-UHFFFAOYSA-N |