1-Cyclopentene-1-carboxylic acid methyl ester is an organic compound featuring a cyclopentene ring with a carboxylic acid methyl ester group attached at the 1st position. This compound is commonly used in organic synthesis as a building block for more complex molecules. Its reactive ester group makes it useful in esterification reactions, while the cyclopentene ring allows for further functionalization. Researchers utilize it in the development of pharmaceuticals, agrochemicals, and materials, exploring its potential applications in various chemical synthesis pathways.
Catalog Number | R018069 |
CAS Number | 25662-28-6 |
Synonyms | 1-(Methoxycarbonyl)cyclopentene; Methyl 1-Cyclopentene-1-carboxylate; Methyl 1-Cyclopentenoate; Methyl Cyclopentene-1-carboxylate |
Molecular Formula | C7H10O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl cyclopentene-1-carboxylate |
InChI | InChI=1S/C7H10O2/c1-9-7(8)6-4-2-3-5-6/h4H,2-3,5H2,1H3 |
InChIKey | VTYCAXIAUKEGBQ-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CCCC1 |