Home
>
Chemical Reagents>Heterocyclic Building Blocks> 1-Cyclopentyl-3-(trifluoromethyl)pyrazole-4-boronic acid
For research use only. Not for therapeutic Use.
1-Cyclopentyl-3-(trifluoromethyl)pyrazole-4-boronic acid(Cat No.:L028349)is a critical intermediate in the synthesis of advanced pharmaceutical compounds, particularly in the development of kinase inhibitors and other targeted therapies. The combination of a cyclopentyl group and a trifluoromethyl pyrazole core enhances the compound’s potential biological activity, making it valuable in medicinal chemistry. Its boronic acid functionality allows for versatile coupling reactions, facilitating the creation of complex molecules. This high-purity compound is essential for researchers aiming to develop novel drugs with improved efficacy and specificity.
Catalog Number | L028349 |
CAS Number | 2304634-13-5 |
Molecular Formula | C9H12BF3N2O2 |
Purity | ≥95% |
IUPAC Name | [1-cyclopentyl-3-(trifluoromethyl)pyrazol-4-yl]boronic acid |
InChI | InChI=1S/C9H12BF3N2O2/c11-9(12,13)8-7(10(16)17)5-15(14-8)6-3-1-2-4-6/h5-6,16-17H,1-4H2 |
InChIKey | JFERHZBESSKOMR-UHFFFAOYSA-N |
SMILES | B(C1=CN(N=C1C(F)(F)F)C2CCCC2)(O)O |