For research use only. Not for therapeutic Use.
1-Cyclopropyl-1H-pyrazole-4-carboxylic acid(Cat No.:L016124)is a specialized compound utilized in pharmaceutical and organic synthesis. Featuring a cyclopropyl group attached to a pyrazole ring with a carboxylic acid at the 4-position, this compound serves as a valuable intermediate in the creation of complex molecules, including potential drug candidates. Its unique structure and reactivity make it essential in medicinal chemistry, enabling the exploration of new therapeutic agents and bioactive compounds. This compound is particularly important in advancing drug discovery and developing innovative chemical pathways.
CAS Number | 1622883-44-6 |
Molecular Formula | C7H8N2O2 |
Purity | ≥95% |
IUPAC Name | 1-cyclopropylpyrazole-4-carboxylic acid |
InChI | InChI=1S/C7H8N2O2/c10-7(11)5-3-8-9(4-5)6-1-2-6/h3-4,6H,1-2H2,(H,10,11) |
InChIKey | AUPHADTZIOYAMZ-UHFFFAOYSA-N |
SMILES | C1CC1N2C=C(C=N2)C(=O)O |