For research use only. Not for therapeutic Use.
<p>
<span style="font-size:12px;"><span style="font-family:arial,helvetica,sans-serif;">1-Cyclopropylmethyl-4-methoxybenzene (CAS 16510-27-3) is a useful chemical. It's used as fragrance and flavour compositions.</span></span></p>
<p class="scroll-target style-scope patent-result" style="-webkit-font-smoothing: antialiased; font-weight: 500; font-size: 20px; margin: 0px 0px 20px; color: rgb(51, 51, 51); font-family: Roboto, sans-serif;">
</p>
| Catalog Number | M075646 |
| CAS Number | 16510-27-3 |
| Synonyms | 1-Cyclopropylmethyl-4-methoxybenzene |
| Molecular Formula | C11H14O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-(cyclopropylmethyl)-4-methoxybenzene |
| InChI | InChI=1S/C11H14O/c1-12-11-6-4-10(5-7-11)8-9-2-3-9/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | SHLSJFDJYSSUIP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CC2CC2 |
| Reference | 1.<span style="font-family: Arial, sans-serif; font-size: 13px;">Goeke, Andreas. "Fragrance and flavour compositions." U.S. Patent No. 7,704,942. 27 Apr. 2010.</span> |
