For research use only. Not for therapeutic Use.
1-Dimethylamino-2-nitroethylene (Cat.No:R021705) is a chemical compound used in organic synthesis. It contains a nitro group and a dimethylamino group in its structure, making it valuable as a versatile intermediate for creating various organic compounds, including pharmaceuticals and agrochemicals. It plays a role as a key building block in chemical research and development.
CAS Number | 1190-92-7 |
Synonyms | N,N-Dimethyl-2-nitrovinylamine; N-(2-Nitrovinyl)dimethylamine; 1-(Dimethylamino)-2-nitroethene; 1-(Dimethylamino)-2-nitroethylene; 1-(N,N-Dimethylamino)-2-nitroethylene; 1-Nitro-2-(dimethylamino)ethylene |
Molecular Formula | C4H8N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (E)-N,N-dimethyl-2-nitroethenamine |
InChI | InChI=1S/C4H8N2O2/c1-5(2)3-4-6(7)8/h3-4H,1-2H3/b4-3+ |
InChIKey | JKOVQYWMFZTKMX-ONEGZZNKSA-N |
SMILES | CN(C)C=C[N+](=O)[O-] |