For research use only. Not for therapeutic Use.
1-Docosahexaenoyl-sn-glycero-3-phosphocholine (DHA-PC) is a phospholipid containing the omega-3 fatty acid docosahexaenoic acid (DHA) attached to a glycerol backbone via a phosphocholine head group. It is a major component of cell membranes and is abundant in brain tissue. DHA-PC is studied for its role in brain function, cardiovascular health, and inflammation regulation. Research explores its therapeutic potential in neurodegenerative diseases and cognitive enhancement, focusing on its effects on membrane structure and signaling pathways.
CAS Number | 162440-05-3 |
Synonyms | (7R,13Z,16Z,19Z,22Z,25Z,28Z)-4,7-Dihydroxy-N,N,N-trimethyl-10-oxo-3,5,9-trioxa-4-phosphahentriaconta-13,16,19,22,25,28-hexaen-1-aminium 4-Oxide |
Molecular Formula | C30H50NO7P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(2R)-3-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-2-hydroxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
InChI | InChI=1S/C30H50NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-30(33)36-27-29(32)28-38-39(34,35)37-26-25-31(2,3)4/h6-7,9-10,12-13,15-16,18-19,21-22,29,32H,5,8,11,14,17,20,23-28H2,1-4H3/b7-6-,10-9-,13-12-,16-15-,19-18-,22-21-/t29-/m1/s1 |
InChIKey | LSOWKZULVQWMLY-APPDJCNMSA-N |
SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)O |