Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 1-Ethyl-1-methyl-4-oxopiperidin-1-ium iodide
For research use only. Not for therapeutic Use.
1-Ethyl-1-methyl-4-oxopiperidin-1-ium iodide (Cat.No:L034215) is a chemical compound with applications in organic synthesis. It is commonly used as a reagent in various reactions, including the synthesis of heterocyclic compounds. Its unique structure and reactivity make it valuable for creating diverse molecules in research and pharmaceutical chemistry.
Catalog Number | L034215 |
CAS Number | 77542-18-8 |
Molecular Formula | C8H16INO |
Purity | ≥95% |
IUPAC Name | 1-ethyl-1-methylpiperidin-1-ium-4-one;iodide |
InChI | InChI=1S/C8H16NO.HI/c1-3-9(2)6-4-8(10)5-7-9;/h3-7H2,1-2H3;1H/q+1;/p-1 |
InChIKey | PIDODLRGSKHQDP-UHFFFAOYSA-M |