For research use only. Not for therapeutic Use.
1-Ethyl-1-methylcyclopentane is a high-purity hydrocarbon essential for advanced pharmaceutical and chemical research. This cyclopentane derivative is crucial for studies involving organic synthesis, fuel research, and chemical intermediates. Known for its stability and well-defined structure, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in diverse scientific applications.
Catalog Number | R020428 |
CAS Number | 16747-50-5 |
Synonyms | 1-Methyl-1-ethylcyclopentane |
Molecular Formula | C8H16 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-ethyl-1-methylcyclopentane |
InChI | InChI=1S/C8H16/c1-3-8(2)6-4-5-7-8/h3-7H2,1-2H3 |
InChIKey | LETYIFNDQBJGPJ-UHFFFAOYSA-N |
SMILES | CCC1(CCCC1)C |