For research use only. Not for therapeutic Use.
1-Ethyl-2,3-dimethylimidazolium bromide(CAT: L023003) is an ionic liquid and imidazolium-based salt, featuring an ethyl group at the 1-position and methyl groups at the 2 and 3 positions on the imidazole ring, with bromide as the counterion. Ionic liquids like this are valued in green chemistry due to their low volatility, thermal stability, and ability to dissolve a wide range of substances. 1-Ethyl-2,3-dimethylimidazolium bromide is commonly used as a solvent and catalyst in organic synthesis, electrochemistry, and materials science, where it promotes reaction efficiency and selectivity. Researchers utilize this ionic liquid in processes such as catalytic transformations, extractions, and electrochemical applications, aiming to reduce environmental impact while enhancing chemical performance.
CAS Number | 98892-76-3 |
Molecular Formula | C7H13BrN2 |
Purity | ≥95% |
IUPAC Name | 1-ethyl-2,3-dimethylimidazol-3-ium;bromide |
InChI | InChI=1S/C7H13N2.BrH/c1-4-9-6-5-8(3)7(9)2;/h5-6H,4H2,1-3H3;1H/q+1;/p-1 |
InChIKey | GITMVCYKHULLDM-UHFFFAOYSA-M |