Home
>
Chemical Reagents>Organometallic Reagents> 1-ethyl-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
For research use only. Not for therapeutic Use.
1-Ethyl-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole(Cat No.:L007804), is a complex organic compound. It contains a pyrazole ring, characterized by a five-membered ring containing two nitrogen atoms and three carbon atoms. Attached to this ring are an ethyl group (C2H5), a methyl group (CH3), and a boron-containing group (4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl). Compounds with boron-containing functional groups are often used as intermediates in organic synthesis, playing a crucial role in the creation of various complex organic molecules.
Catalog Number | L007804 |
CAS Number | 1876473-39-0 |
Molecular Formula | C12H21BN2O2 |
Purity | ≥95% |
IUPAC Name | 1-ethyl-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
InChI | InChI=1S/C12H21BN2O2/c1-7-15-10(8-9(2)14-15)13-16-11(3,4)12(5,6)17-13/h8H,7H2,1-6H3 |
InChIKey | OEIOIWLEZPKVFD-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NN2CC)C |