For research use only. Not for therapeutic Use.
1-Ethyl-3-methylimidazolium tetrafluoroborate (Cat No.:M094734) is a chemical compound. It falls under the category of imidazolium-based ionic liquids. This compound plays a crucial role in diverse fields, including chemistry, materials science, and electrochemistry. As an ionic liquid, it exhibits unique properties such as low volatility, high thermal stability, and tunable solvation abilities. These attributes make it valuable as a solvent, electrolyte, and reaction medium. Its application ranges from green chemistry to energy storage, as it serves as a key component in various electrochemical devices. The compound’s imidazolium cation and tetrafluoroborate anion contribute to its versatility and significance in research and industry.
| Catalog Number | M094734 |
| CAS Number | 143314-16-3 |
| Molecular Formula | C6H11BF4N2 |
| Purity | ≥95% |
| Storage | Sealed in dry,Room Temperature |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;tetrafluoroborate |
| InChI | InChI=1S/C6H11N2.BF4/c1-3-8-5-4-7(2)6-8;2-1(3,4)5/h4-6H,3H2,1-2H3;/q+1;-1 |
| InChIKey | CUNYTRQQXKCRTJ-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CCN1C=C[N+](=C1)C |
