Home
>
Chemical Reagents>Organometallic Reagents> 1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2(1H)-one
For research use only. Not for therapeutic Use.
1-Ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2(1H)-one is a boron-containing heterocyclic compound commonly used in pharmaceutical and synthetic chemistry. Featuring a dioxaborolane group attached to a pyridinone ring, this compound is a valuable intermediate for Suzuki-Miyaura cross-coupling reactions, enabling the synthesis of complex organic molecules. Its structure allows for targeted modifications in medicinal chemistry, making it ideal for the development of bioactive compounds. Its stability and reactivity support diverse applications in drug discovery and advanced material synthesis.
CAS Number | 1349734-00-4 |
Molecular Formula | C13H20BNO3 |
Purity | ≥95% |
IUPAC Name | 1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
InChI | InChI=1S/C13H20BNO3/c1-6-15-9-10(7-8-11(15)16)14-17-12(2,3)13(4,5)18-14/h7-9H,6H2,1-5H3 |
InChIKey | GARRLDCODNEYEC-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C(=O)C=C2)CC |