For research use only. Not for therapeutic Use.
1-Ethylallyl acetate is an organic ester featuring an ethylallyl group attached to an acetate functional group. This compound is commonly used as a flavoring agent and fragrance component due to its pleasant, fruity aroma. It is also of interest in organic synthesis as an intermediate for creating more complex molecules. Its ester group allows for versatile chemical reactions, including hydrolysis and transesterification, making it useful in producing flavors, fragrances, and other fine chemicals in various industrial applications.
Catalog Number | M063736 |
CAS Number | 10500-11-5 |
Molecular Formula | C7H12O2 |
Purity | ≥95% |
Storage | Store at +4 ℃ |
IUPAC Name | pent-1-en-3-yl acetate |
InChI | InChI=1S/C7H12O2/c1-4-7(5-2)9-6(3)8/h4,7H,1,5H2,2-3H3 |
InChIKey | MRLKTTBPWZXARX-UHFFFAOYSA-N |
SMILES | CCC(C=C)OC(=O)C |